C21H39N5O5 — CID 71430120
4-acetamido-N-[4-oxo-4-[[4-oxo-4-[[4-oxo-4-(propylamino)butyl]amino]butyl]amino]butyl]butanamide (PubChem CID 71430120) has the molecular formula C21H39N5O5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-acetamido-N-[4-oxo-4-[[4-oxo-4-[[4-oxo-4-(propylamino)butyl]amino]butyl]amino]butyl]butanamide.
| Compound Name | 4-acetamido-N-[4-oxo-4-[[4-oxo-4-[[4-oxo-4-(propylamino)butyl]amino]butyl]amino]butyl]butanamide |
|---|---|
| PubChem CID | 71430120 |
| Molecular Formula | C21H39N5O5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 4-acetamido-N-[4-oxo-4-[[4-oxo-4-[[4-oxo-4-(propylamino)butyl]amino]butyl]amino]butyl]butanamide |
| SMILES | CCCNC(=O)CCCNC(=O)CCCNC(=O)CCCNC(=O)CCCNC(C)=O |
| InChI | InChI=1S/C21H39N5O5/c1-3-12-23-18(28)9-5-14-25-20(30)11-7-16-26-21(31)10-6-15-24-19(29)8-4-13-22-17(2)27/h3-16H2,1-2H3,(H,22,27)(H,23,28)(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | QGZHRYDPVPMKDQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|