About N-(8-oxononyl)acetamide
N-(8-oxononyl)acetamide (PubChem CID 58114719) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(8-oxononyl)acetamide.
Molecular Properties
| Compound Name | N-(8-oxononyl)acetamide |
| PubChem CID | 58114719 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(8-oxononyl)acetamide |
| SMILES | CC(=O)CCCCCCCNC(C)=O |
| InChI | InChI=1S/C11H21NO2/c1-10(13)8-6-4-3-5-7-9-12-11(2)14/h3-9H2,1-2H3,(H,12,14) |
| InChIKey | UEIHWGGKRUIUTE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(8-oxononyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-oxononyl)acetamide?
The IUPAC name of N-(8-oxononyl)acetamide (CID 58114719) is N-(8-oxononyl)acetamide.
What is the SMILES notation for N-(8-oxononyl)acetamide?
The canonical SMILES for N-(8-oxononyl)acetamide is CC(=O)CCCCCCCNC(C)=O.
What is the InChIKey of N-(8-oxononyl)acetamide?
The InChIKey is UEIHWGGKRUIUTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-10(13)8-6-4-3-5-7-9-12-11(2)14/h3-9H2,1-2H3,(H,12,14).
What are the key properties of N-(8-oxononyl)acetamide?
N-(8-oxononyl)acetamide has a molecular weight of 199.29 g/mol, XLogP of 2.05, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-oxononyl)acetamide is sourced from PubChem (CID 58114719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).