About CID 59075972
CID 59075972 (PubChem CID 59075972) has the molecular formula C5H11N2O+
and a molecular weight of 115.16 g/mol.
Molecular Properties
| Compound Name | CID 59075972 |
| PubChem CID | 59075972 |
| Molecular Formula | C5H11N2O+ |
| Molecular Weight | 115.16 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | — |
| SMILES | CC(=O)NCCC[NH+] |
| InChI | InChI=1S/C5H11N2O/c1-5(8)7-4-2-3-6/h6H,2-4H2,1H3,(H,7,8)/q+1 |
| InChIKey | SBOUVKOYTGOJDK-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.16 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59075972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59075972?
The IUPAC name of CID 59075972 (CID 59075972) is not available.
What is the SMILES notation for CID 59075972?
The canonical SMILES for CID 59075972 is CC(=O)NCCC[NH+].
What is the InChIKey of CID 59075972?
The InChIKey is SBOUVKOYTGOJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2O/c1-5(8)7-4-2-3-6/h6H,2-4H2,1H3,(H,7,8)/q+1.
What are the key properties of CID 59075972?
CID 59075972 has a molecular weight of 115.16 g/mol, XLogP of -1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59075972 is sourced from PubChem (CID 59075972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).