About 1-butyl-3-octylurea;fluoroboronic acid
1-butyl-3-octylurea;fluoroboronic acid (PubChem CID 19004852) has the molecular formula C13H36B4F4N2O9
and a molecular weight of 483.68 g/mol. Its IUPAC name is 1-butyl-3-octylurea;fluoroboronic acid.
Molecular Properties
| Compound Name | 1-butyl-3-octylurea;fluoroboronic acid |
| PubChem CID | 19004852 |
| Molecular Formula | C13H36B4F4N2O9 |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 1-butyl-3-octylurea;fluoroboronic acid |
| SMILES | CCCCCCCCNC(=O)NCCCC.OB(O)F.OB(O)F.OB(O)F.OB(O)F |
| InChI | InChI=1S/C13H28N2O.4BFH2O2/c1-3-5-7-8-9-10-12-15-13(16)14-11-6-4-2;4*2-1(3)4/h3-12H2,1-2H3,(H2,14,15,16);4*3-4H |
| InChIKey | CSEBXRSDGGCKCV-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 202.97 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-octylurea;fluoroboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-octylurea;fluoroboronic acid?
The IUPAC name of 1-butyl-3-octylurea;fluoroboronic acid (CID 19004852) is 1-butyl-3-octylurea;fluoroboronic acid.
What is the SMILES notation for 1-butyl-3-octylurea;fluoroboronic acid?
The canonical SMILES for 1-butyl-3-octylurea;fluoroboronic acid is CCCCCCCCNC(=O)NCCCC.OB(O)F.OB(O)F.OB(O)F.OB(O)F.
What is the InChIKey of 1-butyl-3-octylurea;fluoroboronic acid?
The InChIKey is CSEBXRSDGGCKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O.4BFH2O2/c1-3-5-7-8-9-10-12-15-13(16)14-11-6-4-2;4*2-1(3)4/h3-12H2,1-2H3,(H2,14,15,16);4*3-4H.
What are the key properties of 1-butyl-3-octylurea;fluoroboronic acid?
1-butyl-3-octylurea;fluoroboronic acid has a molecular weight of 483.68 g/mol, XLogP of -0.85, 10 rotatable bonds, 10 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-octylurea;fluoroboronic acid is sourced from PubChem (CID 19004852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).