About 1-hexyl-3-hydroxyurea
1-hexyl-3-hydroxyurea (PubChem CID 57210959) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-hexyl-3-hydroxyurea.
Molecular Properties
| Compound Name | 1-hexyl-3-hydroxyurea |
| PubChem CID | 57210959 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 1-hexyl-3-hydroxyurea |
| SMILES | CCCCCCNC(=O)NO |
| InChI | InChI=1S/C7H16N2O2/c1-2-3-4-5-6-8-7(10)9-11/h11H,2-6H2,1H3,(H2,8,9,10) |
| InChIKey | BUNNGDYZRGIBEH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-3-hydroxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-3-hydroxyurea?
The IUPAC name of 1-hexyl-3-hydroxyurea (CID 57210959) is 1-hexyl-3-hydroxyurea.
What is the SMILES notation for 1-hexyl-3-hydroxyurea?
The canonical SMILES for 1-hexyl-3-hydroxyurea is CCCCCCNC(=O)NO.
What is the InChIKey of 1-hexyl-3-hydroxyurea?
The InChIKey is BUNNGDYZRGIBEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-2-3-4-5-6-8-7(10)9-11/h11H,2-6H2,1H3,(H2,8,9,10).
What are the key properties of 1-hexyl-3-hydroxyurea?
1-hexyl-3-hydroxyurea has a molecular weight of 160.22 g/mol, XLogP of 1.26, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-3-hydroxyurea is sourced from PubChem (CID 57210959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).