About 1-propyl-3-tridecylurea
1-propyl-3-tridecylurea (PubChem CID 10934987) has the molecular formula C17H36N2O
and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-propyl-3-tridecylurea.
Molecular Properties
| Compound Name | 1-propyl-3-tridecylurea |
| PubChem CID | 10934987 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 1-propyl-3-tridecylurea |
| SMILES | CCCCCCCCCCCCCNC(=O)NCCC |
| InChI | InChI=1S/C17H36N2O/c1-3-5-6-7-8-9-10-11-12-13-14-16-19-17(20)18-15-4-2/h3-16H2,1-2H3,(H2,18,19,20) |
| InChIKey | KTCDRXGQMBORFA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-propyl-3-tridecylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-3-tridecylurea?
The IUPAC name of 1-propyl-3-tridecylurea (CID 10934987) is 1-propyl-3-tridecylurea.
What is the SMILES notation for 1-propyl-3-tridecylurea?
The canonical SMILES for 1-propyl-3-tridecylurea is CCCCCCCCCCCCCNC(=O)NCCC.
What is the InChIKey of 1-propyl-3-tridecylurea?
The InChIKey is KTCDRXGQMBORFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N2O/c1-3-5-6-7-8-9-10-11-12-13-14-16-19-17(20)18-15-4-2/h3-16H2,1-2H3,(H2,18,19,20).
What are the key properties of 1-propyl-3-tridecylurea?
1-propyl-3-tridecylurea has a molecular weight of 284.49 g/mol, XLogP of 5.01, 14 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-3-tridecylurea is sourced from PubChem (CID 10934987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).