C44H86N4O2 — CID 159541193
1-[(Z)-octadec-9-enyl]-3-[6-[[(Z)-octadec-9-enyl]carbamoylamino]hexyl]urea (PubChem CID 159541193) has the molecular formula C44H86N4O2 and a molecular weight of 703.20 g/mol. Its IUPAC name is 1-[(Z)-octadec-9-enyl]-3-[6-[[(Z)-octadec-9-enyl]carbamoylamino]hexyl]urea.
| Compound Name | 1-[(Z)-octadec-9-enyl]-3-[6-[[(Z)-octadec-9-enyl]carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 159541193 |
| Molecular Formula | C44H86N4O2 |
| Molecular Weight | 703.20 g/mol |
| Exact Mass | 702.68 |
| IUPAC Name | 1-[(Z)-octadec-9-enyl]-3-[6-[[(Z)-octadec-9-enyl]carbamoylamino]hexyl]urea |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)NCCCCCCNC(=O)NCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H86N4O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-39-45-43(49)47-41-37-33-34-38-42-48-44(50)46-40-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-42H2,1-2H3,(H2,45,47,49)(H2,46,48,50)/b19-17-,20-18- |
| InChIKey | DMALVJGLDYADMY-CLFAGFIQSA-N |
| XLogP | 13.22 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.20 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|