About N-butylcarbamoyl chloride
N-butylcarbamoyl chloride (PubChem CID 14251115) has the molecular formula C5H10ClNO
and a molecular weight of 135.59 g/mol. Its IUPAC name is N-butylcarbamoyl chloride.
Molecular Properties
| Compound Name | N-butylcarbamoyl chloride |
| PubChem CID | 14251115 |
| Molecular Formula | C5H10ClNO |
| Molecular Weight | 135.59 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | N-butylcarbamoyl chloride |
| SMILES | CCCCNC(=O)Cl |
| InChI | InChI=1S/C5H10ClNO/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H,7,8) |
| InChIKey | HXMTZADTMCGSBJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-butylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylcarbamoyl chloride?
The IUPAC name of N-butylcarbamoyl chloride (CID 14251115) is N-butylcarbamoyl chloride.
What is the SMILES notation for N-butylcarbamoyl chloride?
The canonical SMILES for N-butylcarbamoyl chloride is CCCCNC(=O)Cl.
What is the InChIKey of N-butylcarbamoyl chloride?
The InChIKey is HXMTZADTMCGSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H,7,8).
What are the key properties of N-butylcarbamoyl chloride?
N-butylcarbamoyl chloride has a molecular weight of 135.59 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylcarbamoyl chloride is sourced from PubChem (CID 14251115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).