N-nonylcarbamoyl chloride

C10H20ClNO — CID 89287231

IUPACN-nonylcarbamoyl chloride
SMILESCCCCCCCCCNC(=O)Cl
InChIInChI=1S/C10H20ClNO/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H,12,13)
InChIKeyVUVUFAYVUBJFRR-UHFFFAOYSA-N
MW205.73 g/mol
LogP3.69
Rot. Bonds8

About N-nonylcarbamoyl chloride

N-nonylcarbamoyl chloride (PubChem CID 89287231) has the molecular formula C10H20ClNO and a molecular weight of 205.73 g/mol. Its IUPAC name is N-nonylcarbamoyl chloride.

Molecular Properties

Compound NameN-nonylcarbamoyl chloride
PubChem CID89287231
Molecular FormulaC10H20ClNO
Molecular Weight205.73 g/mol
Exact Mass205.12
IUPAC NameN-nonylcarbamoyl chloride
SMILESCCCCCCCCCNC(=O)Cl
InChIInChI=1S/C10H20ClNO/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H,12,13)
InChIKeyVUVUFAYVUBJFRR-UHFFFAOYSA-N
XLogP3.69
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.73
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-nonylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-nonylcarbamoyl chloride?
The IUPAC name of N-nonylcarbamoyl chloride (CID 89287231) is N-nonylcarbamoyl chloride.
What is the SMILES notation for N-nonylcarbamoyl chloride?
The canonical SMILES for N-nonylcarbamoyl chloride is CCCCCCCCCNC(=O)Cl.
What is the InChIKey of N-nonylcarbamoyl chloride?
The InChIKey is VUVUFAYVUBJFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H,12,13).
What are the key properties of N-nonylcarbamoyl chloride?
N-nonylcarbamoyl chloride has a molecular weight of 205.73 g/mol, XLogP of 3.69, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonylcarbamoyl chloride is sourced from PubChem (CID 89287231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).