About N-nonylcarbamoyl chloride
N-nonylcarbamoyl chloride (PubChem CID 89287231) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is N-nonylcarbamoyl chloride.
Molecular Properties
| Compound Name | N-nonylcarbamoyl chloride |
| PubChem CID | 89287231 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-nonylcarbamoyl chloride |
| SMILES | CCCCCCCCCNC(=O)Cl |
| InChI | InChI=1S/C10H20ClNO/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H,12,13) |
| InChIKey | VUVUFAYVUBJFRR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-nonylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonylcarbamoyl chloride?
The IUPAC name of N-nonylcarbamoyl chloride (CID 89287231) is N-nonylcarbamoyl chloride.
What is the SMILES notation for N-nonylcarbamoyl chloride?
The canonical SMILES for N-nonylcarbamoyl chloride is CCCCCCCCCNC(=O)Cl.
What is the InChIKey of N-nonylcarbamoyl chloride?
The InChIKey is VUVUFAYVUBJFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H,12,13).
What are the key properties of N-nonylcarbamoyl chloride?
N-nonylcarbamoyl chloride has a molecular weight of 205.73 g/mol, XLogP of 3.69, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonylcarbamoyl chloride is sourced from PubChem (CID 89287231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).