About octylcarbamothioic S-acid
octylcarbamothioic S-acid (PubChem CID 25085683) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is octylcarbamothioic S-acid.
Molecular Properties
| Compound Name | octylcarbamothioic S-acid |
| PubChem CID | 25085683 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | octylcarbamothioic S-acid |
| SMILES | CCCCCCCCNC(=O)S |
| InChI | InChI=1S/C9H19NOS/c1-2-3-4-5-6-7-8-10-9(11)12/h2-8H2,1H3,(H2,10,11,12) |
| InChIKey | RQMISGSERXWITM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze octylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octylcarbamothioic S-acid?
The IUPAC name of octylcarbamothioic S-acid (CID 25085683) is octylcarbamothioic S-acid.
What is the SMILES notation for octylcarbamothioic S-acid?
The canonical SMILES for octylcarbamothioic S-acid is CCCCCCCCNC(=O)S.
What is the InChIKey of octylcarbamothioic S-acid?
The InChIKey is RQMISGSERXWITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS/c1-2-3-4-5-6-7-8-10-9(11)12/h2-8H2,1H3,(H2,10,11,12).
What are the key properties of octylcarbamothioic S-acid?
octylcarbamothioic S-acid has a molecular weight of 189.32 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octylcarbamothioic S-acid is sourced from PubChem (CID 25085683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).