About ethane;methanethiol;N-nonylpropanamide
ethane;methanethiol;N-nonylpropanamide (PubChem CID 177150000) has the molecular formula C17H41NOS
and a molecular weight of 307.59 g/mol. Its IUPAC name is ethane;methanethiol;N-nonylpropanamide.
Molecular Properties
| Compound Name | ethane;methanethiol;N-nonylpropanamide |
| PubChem CID | 177150000 |
| Molecular Formula | C17H41NOS |
| Molecular Weight | 307.59 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | ethane;methanethiol;N-nonylpropanamide |
| SMILES | CC.CC.CCCCCCCCCNC(=O)CC.CS |
| InChI | InChI=1S/C12H25NO.2C2H6.CH4S/c1-3-5-6-7-8-9-10-11-13-12(14)4-2;3*1-2/h3-11H2,1-2H3,(H,13,14);2*1-2H3;2H,1H3 |
| InChIKey | DJSKAQAMMCRKNR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanethiol;N-nonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanethiol;N-nonylpropanamide?
The IUPAC name of ethane;methanethiol;N-nonylpropanamide (CID 177150000) is ethane;methanethiol;N-nonylpropanamide.
What is the SMILES notation for ethane;methanethiol;N-nonylpropanamide?
The canonical SMILES for ethane;methanethiol;N-nonylpropanamide is CC.CC.CCCCCCCCCNC(=O)CC.CS.
What is the InChIKey of ethane;methanethiol;N-nonylpropanamide?
The InChIKey is DJSKAQAMMCRKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO.2C2H6.CH4S/c1-3-5-6-7-8-9-10-11-13-12(14)4-2;3*1-2/h3-11H2,1-2H3,(H,13,14);2*1-2H3;2H,1H3.
What are the key properties of ethane;methanethiol;N-nonylpropanamide?
ethane;methanethiol;N-nonylpropanamide has a molecular weight of 307.59 g/mol, XLogP of 5.86, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanethiol;N-nonylpropanamide is sourced from PubChem (CID 177150000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).