About ethane;N-undecylpropanamide
ethane;N-undecylpropanamide (PubChem CID 155706114) has the molecular formula C16H35NO
and a molecular weight of 257.46 g/mol. Its IUPAC name is ethane;N-undecylpropanamide.
Molecular Properties
| Compound Name | ethane;N-undecylpropanamide |
| PubChem CID | 155706114 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | ethane;N-undecylpropanamide |
| SMILES | CC.CCCCCCCCCCCNC(=O)CC |
| InChI | InChI=1S/C14H29NO.C2H6/c1-3-5-6-7-8-9-10-11-12-13-15-14(16)4-2;1-2/h3-13H2,1-2H3,(H,15,16);1-2H3 |
| InChIKey | QTFJRIRQKSCCEA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-undecylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-undecylpropanamide?
The IUPAC name of ethane;N-undecylpropanamide (CID 155706114) is ethane;N-undecylpropanamide.
What is the SMILES notation for ethane;N-undecylpropanamide?
The canonical SMILES for ethane;N-undecylpropanamide is CC.CCCCCCCCCCCNC(=O)CC.
What is the InChIKey of ethane;N-undecylpropanamide?
The InChIKey is QTFJRIRQKSCCEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO.C2H6/c1-3-5-6-7-8-9-10-11-12-13-15-14(16)4-2;1-2/h3-13H2,1-2H3,(H,15,16);1-2H3.
What are the key properties of ethane;N-undecylpropanamide?
ethane;N-undecylpropanamide has a molecular weight of 257.46 g/mol, XLogP of 5.07, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-undecylpropanamide is sourced from PubChem (CID 155706114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).