About N-heptylcarbamoyl fluoride
N-heptylcarbamoyl fluoride (PubChem CID 135303527) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is N-heptylcarbamoyl fluoride.
Molecular Properties
| Compound Name | N-heptylcarbamoyl fluoride |
| PubChem CID | 135303527 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-heptylcarbamoyl fluoride |
| SMILES | CCCCCCCNC(=O)F |
| InChI | InChI=1S/C8H16FNO/c1-2-3-4-5-6-7-10-8(9)11/h2-7H2,1H3,(H,10,11) |
| InChIKey | SKEZOOLOUUBVHE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-heptylcarbamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptylcarbamoyl fluoride?
The IUPAC name of N-heptylcarbamoyl fluoride (CID 135303527) is N-heptylcarbamoyl fluoride.
What is the SMILES notation for N-heptylcarbamoyl fluoride?
The canonical SMILES for N-heptylcarbamoyl fluoride is CCCCCCCNC(=O)F.
What is the InChIKey of N-heptylcarbamoyl fluoride?
The InChIKey is SKEZOOLOUUBVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO/c1-2-3-4-5-6-7-10-8(9)11/h2-7H2,1H3,(H,10,11).
What are the key properties of N-heptylcarbamoyl fluoride?
N-heptylcarbamoyl fluoride has a molecular weight of 161.22 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptylcarbamoyl fluoride is sourced from PubChem (CID 135303527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).