About N-butylcarbamothioyl chloride
N-butylcarbamothioyl chloride (PubChem CID 135275967) has the molecular formula C5H10ClNS
and a molecular weight of 151.66 g/mol. Its IUPAC name is N-butylcarbamothioyl chloride.
Molecular Properties
| Compound Name | N-butylcarbamothioyl chloride |
| PubChem CID | 135275967 |
| Molecular Formula | C5H10ClNS |
| Molecular Weight | 151.66 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | N-butylcarbamothioyl chloride |
| SMILES | CCCCNC(=S)Cl |
| InChI | InChI=1S/C5H10ClNS/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H,7,8) |
| InChIKey | BGABHZOTLVPSEL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.66 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-butylcarbamothioyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylcarbamothioyl chloride?
The IUPAC name of N-butylcarbamothioyl chloride (CID 135275967) is N-butylcarbamothioyl chloride.
What is the SMILES notation for N-butylcarbamothioyl chloride?
The canonical SMILES for N-butylcarbamothioyl chloride is CCCCNC(=S)Cl.
What is the InChIKey of N-butylcarbamothioyl chloride?
The InChIKey is BGABHZOTLVPSEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNS/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H,7,8).
What are the key properties of N-butylcarbamothioyl chloride?
N-butylcarbamothioyl chloride has a molecular weight of 151.66 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylcarbamothioyl chloride is sourced from PubChem (CID 135275967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).