About butyl N-butylcarbamodithioate;tungsten
butyl N-butylcarbamodithioate;tungsten (PubChem CID 174676976) has the molecular formula C9H19NS2W
and a molecular weight of 389.23 g/mol. Its IUPAC name is butyl N-butylcarbamodithioate;tungsten.
Molecular Properties
| Compound Name | butyl N-butylcarbamodithioate;tungsten |
| PubChem CID | 174676976 |
| Molecular Formula | C9H19NS2W |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | butyl N-butylcarbamodithioate;tungsten |
| SMILES | CCCCNC(=S)SCCCC.[W] |
| InChI | InChI=1S/C9H19NS2.W/c1-3-5-7-10-9(11)12-8-6-4-2;/h3-8H2,1-2H3,(H,10,11); |
| InChIKey | QSEKXSSXXJNKAG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butyl N-butylcarbamodithioate;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-butylcarbamodithioate;tungsten?
The IUPAC name of butyl N-butylcarbamodithioate;tungsten (CID 174676976) is butyl N-butylcarbamodithioate;tungsten.
What is the SMILES notation for butyl N-butylcarbamodithioate;tungsten?
The canonical SMILES for butyl N-butylcarbamodithioate;tungsten is CCCCNC(=S)SCCCC.[W].
What is the InChIKey of butyl N-butylcarbamodithioate;tungsten?
The InChIKey is QSEKXSSXXJNKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2.W/c1-3-5-7-10-9(11)12-8-6-4-2;/h3-8H2,1-2H3,(H,10,11);.
What are the key properties of butyl N-butylcarbamodithioate;tungsten?
butyl N-butylcarbamodithioate;tungsten has a molecular weight of 389.23 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-butylcarbamodithioate;tungsten is sourced from PubChem (CID 174676976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).