About lithium;butyl N-butylcarbamodithioate;hydride
lithium;butyl N-butylcarbamodithioate;hydride (PubChem CID 175317251) has the molecular formula C9H20LiNS2
and a molecular weight of 213.34 g/mol. Its IUPAC name is lithium;butyl N-butylcarbamodithioate;hydride.
Molecular Properties
| Compound Name | lithium;butyl N-butylcarbamodithioate;hydride |
| PubChem CID | 175317251 |
| Molecular Formula | C9H20LiNS2 |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | lithium;butyl N-butylcarbamodithioate;hydride |
| SMILES | CCCCNC(=S)SCCCC.[H-].[Li+] |
| InChI | InChI=1S/C9H19NS2.Li.H/c1-3-5-7-10-9(11)12-8-6-4-2;;/h3-8H2,1-2H3,(H,10,11);;/q;+1;-1 |
| InChIKey | LZYGLLWEPBOQNW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze lithium;butyl N-butylcarbamodithioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;butyl N-butylcarbamodithioate;hydride?
The IUPAC name of lithium;butyl N-butylcarbamodithioate;hydride (CID 175317251) is lithium;butyl N-butylcarbamodithioate;hydride.
What is the SMILES notation for lithium;butyl N-butylcarbamodithioate;hydride?
The canonical SMILES for lithium;butyl N-butylcarbamodithioate;hydride is CCCCNC(=S)SCCCC.[H-].[Li+].
What is the InChIKey of lithium;butyl N-butylcarbamodithioate;hydride?
The InChIKey is LZYGLLWEPBOQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2.Li.H/c1-3-5-7-10-9(11)12-8-6-4-2;;/h3-8H2,1-2H3,(H,10,11);;/q;+1;-1.
What are the key properties of lithium;butyl N-butylcarbamodithioate;hydride?
lithium;butyl N-butylcarbamodithioate;hydride has a molecular weight of 213.34 g/mol, XLogP of 0.31, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;butyl N-butylcarbamodithioate;hydride is sourced from PubChem (CID 175317251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).