About pentyl N-pentylcarbamodithioate;zinc
pentyl N-pentylcarbamodithioate;zinc (PubChem CID 175108822) has the molecular formula C11H23NS2Zn
and a molecular weight of 298.84 g/mol. Its IUPAC name is pentyl N-pentylcarbamodithioate;zinc.
Molecular Properties
| Compound Name | pentyl N-pentylcarbamodithioate;zinc |
| PubChem CID | 175108822 |
| Molecular Formula | C11H23NS2Zn |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | pentyl N-pentylcarbamodithioate;zinc |
| SMILES | CCCCCNC(=S)SCCCCC.[Zn] |
| InChI | InChI=1S/C11H23NS2.Zn/c1-3-5-7-9-12-11(13)14-10-8-6-4-2;/h3-10H2,1-2H3,(H,12,13); |
| InChIKey | HOGPFYSZNYSUAU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentyl N-pentylcarbamodithioate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl N-pentylcarbamodithioate;zinc?
The IUPAC name of pentyl N-pentylcarbamodithioate;zinc (CID 175108822) is pentyl N-pentylcarbamodithioate;zinc.
What is the SMILES notation for pentyl N-pentylcarbamodithioate;zinc?
The canonical SMILES for pentyl N-pentylcarbamodithioate;zinc is CCCCCNC(=S)SCCCCC.[Zn].
What is the InChIKey of pentyl N-pentylcarbamodithioate;zinc?
The InChIKey is HOGPFYSZNYSUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS2.Zn/c1-3-5-7-9-12-11(13)14-10-8-6-4-2;/h3-10H2,1-2H3,(H,12,13);.
What are the key properties of pentyl N-pentylcarbamodithioate;zinc?
pentyl N-pentylcarbamodithioate;zinc has a molecular weight of 298.84 g/mol, XLogP of 3.97, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl N-pentylcarbamodithioate;zinc is sourced from PubChem (CID 175108822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).