About pentylthiourea;hydrochloride
pentylthiourea;hydrochloride (PubChem CID 87769181) has the molecular formula C6H15ClN2S
and a molecular weight of 182.72 g/mol. Its IUPAC name is pentylthiourea;hydrochloride.
Molecular Properties
| Compound Name | pentylthiourea;hydrochloride |
| PubChem CID | 87769181 |
| Molecular Formula | C6H15ClN2S |
| Molecular Weight | 182.72 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | pentylthiourea;hydrochloride |
| SMILES | CCCCCNC(N)=S.Cl |
| InChI | InChI=1S/C6H14N2S.ClH/c1-2-3-4-5-8-6(7)9;/h2-5H2,1H3,(H3,7,8,9);1H |
| InChIKey | WLZQOCPILOAJPM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentylthiourea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentylthiourea;hydrochloride?
The IUPAC name of pentylthiourea;hydrochloride (CID 87769181) is pentylthiourea;hydrochloride.
What is the SMILES notation for pentylthiourea;hydrochloride?
The canonical SMILES for pentylthiourea;hydrochloride is CCCCCNC(N)=S.Cl.
What is the InChIKey of pentylthiourea;hydrochloride?
The InChIKey is WLZQOCPILOAJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2S.ClH/c1-2-3-4-5-8-6(7)9;/h2-5H2,1H3,(H3,7,8,9);1H.
What are the key properties of pentylthiourea;hydrochloride?
pentylthiourea;hydrochloride has a molecular weight of 182.72 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentylthiourea;hydrochloride is sourced from PubChem (CID 87769181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).