About N-butylheptanethioamide
N-butylheptanethioamide (PubChem CID 88529052) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is N-butylheptanethioamide.
Molecular Properties
| Compound Name | N-butylheptanethioamide |
| PubChem CID | 88529052 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N-butylheptanethioamide |
| SMILES | CCCCCCC(=S)NCCCC |
| InChI | InChI=1S/C11H23NS/c1-3-5-7-8-9-11(13)12-10-6-4-2/h3-10H2,1-2H3,(H,12,13) |
| InChIKey | JBGDYQOKRXTXNQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-butylheptanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylheptanethioamide?
The IUPAC name of N-butylheptanethioamide (CID 88529052) is N-butylheptanethioamide.
What is the SMILES notation for N-butylheptanethioamide?
The canonical SMILES for N-butylheptanethioamide is CCCCCCC(=S)NCCCC.
What is the InChIKey of N-butylheptanethioamide?
The InChIKey is JBGDYQOKRXTXNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS/c1-3-5-7-8-9-11(13)12-10-6-4-2/h3-10H2,1-2H3,(H,12,13).
What are the key properties of N-butylheptanethioamide?
N-butylheptanethioamide has a molecular weight of 201.38 g/mol, XLogP of 3.67, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylheptanethioamide is sourced from PubChem (CID 88529052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).