About N-hydroxyhexanethioamide
N-hydroxyhexanethioamide (PubChem CID 15073587) has the molecular formula C6H13NOS
and a molecular weight of 147.24 g/mol. Its IUPAC name is N-hydroxyhexanethioamide.
Molecular Properties
| Compound Name | N-hydroxyhexanethioamide |
| PubChem CID | 15073587 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | N-hydroxyhexanethioamide |
| SMILES | CCCCCC(=S)NO |
| InChI | InChI=1S/C6H13NOS/c1-2-3-4-5-6(9)7-8/h8H,2-5H2,1H3,(H,7,9) |
| InChIKey | NUVGQZKUHNKMEH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyhexanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyhexanethioamide?
The IUPAC name of N-hydroxyhexanethioamide (CID 15073587) is N-hydroxyhexanethioamide.
What is the SMILES notation for N-hydroxyhexanethioamide?
The canonical SMILES for N-hydroxyhexanethioamide is CCCCCC(=S)NO.
What is the InChIKey of N-hydroxyhexanethioamide?
The InChIKey is NUVGQZKUHNKMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOS/c1-2-3-4-5-6(9)7-8/h8H,2-5H2,1H3,(H,7,9).
What are the key properties of N-hydroxyhexanethioamide?
N-hydroxyhexanethioamide has a molecular weight of 147.24 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyhexanethioamide is sourced from PubChem (CID 15073587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).