About N-hydroxytridecanamide
N-hydroxytridecanamide (PubChem CID 14122613) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is N-hydroxytridecanamide.
Molecular Properties
| Compound Name | N-hydroxytridecanamide |
| PubChem CID | 14122613 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-hydroxytridecanamide |
| SMILES | CCCCCCCCCCCCC(=O)NO |
| InChI | InChI=1S/C13H27NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14-16/h16H,2-12H2,1H3,(H,14,15) |
| InChIKey | PYHXOAIZNLYQHA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxytridecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxytridecanamide?
The IUPAC name of N-hydroxytridecanamide (CID 14122613) is N-hydroxytridecanamide.
What is the SMILES notation for N-hydroxytridecanamide?
The canonical SMILES for N-hydroxytridecanamide is CCCCCCCCCCCCC(=O)NO.
What is the InChIKey of N-hydroxytridecanamide?
The InChIKey is PYHXOAIZNLYQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14-16/h16H,2-12H2,1H3,(H,14,15).
What are the key properties of N-hydroxytridecanamide?
N-hydroxytridecanamide has a molecular weight of 229.36 g/mol, XLogP of 3.80, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxytridecanamide is sourced from PubChem (CID 14122613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).