About N-decanoyldecanamide
N-decanoyldecanamide (PubChem CID 87914075) has the molecular formula C20H39NO2
and a molecular weight of 325.54 g/mol. Its IUPAC name is N-decanoyldecanamide.
Molecular Properties
| Compound Name | N-decanoyldecanamide |
| PubChem CID | 87914075 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | N-decanoyldecanamide |
| SMILES | CCCCCCCCCC(=O)NC(=O)CCCCCCCCC |
| InChI | InChI=1S/C20H39NO2/c1-3-5-7-9-11-13-15-17-19(22)21-20(23)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3,(H,21,22,23) |
| InChIKey | OHLAVWFEHQGNPO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decanoyldecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decanoyldecanamide?
The IUPAC name of N-decanoyldecanamide (CID 87914075) is N-decanoyldecanamide.
What is the SMILES notation for N-decanoyldecanamide?
The canonical SMILES for N-decanoyldecanamide is CCCCCCCCCC(=O)NC(=O)CCCCCCCCC.
What is the InChIKey of N-decanoyldecanamide?
The InChIKey is OHLAVWFEHQGNPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO2/c1-3-5-7-9-11-13-15-17-19(22)21-20(23)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3,(H,21,22,23).
What are the key properties of N-decanoyldecanamide?
N-decanoyldecanamide has a molecular weight of 325.54 g/mol, XLogP of 5.91, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-decanoyldecanamide is sourced from PubChem (CID 87914075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).