About N-acetylundecanamide
N-acetylundecanamide (PubChem CID 18949728) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is N-acetylundecanamide.
Molecular Properties
| Compound Name | N-acetylundecanamide |
| PubChem CID | 18949728 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | N-acetylundecanamide |
| SMILES | CCCCCCCCCCC(=O)NC(C)=O |
| InChI | InChI=1S/C13H25NO2/c1-3-4-5-6-7-8-9-10-11-13(16)14-12(2)15/h3-11H2,1-2H3,(H,14,15,16) |
| InChIKey | QMERDVPTCYDEQH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-acetylundecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetylundecanamide?
The IUPAC name of N-acetylundecanamide (CID 18949728) is N-acetylundecanamide.
What is the SMILES notation for N-acetylundecanamide?
The canonical SMILES for N-acetylundecanamide is CCCCCCCCCCC(=O)NC(C)=O.
What is the InChIKey of N-acetylundecanamide?
The InChIKey is QMERDVPTCYDEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-3-4-5-6-7-8-9-10-11-13(16)14-12(2)15/h3-11H2,1-2H3,(H,14,15,16).
What are the key properties of N-acetylundecanamide?
N-acetylundecanamide has a molecular weight of 227.35 g/mol, XLogP of 3.18, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetylundecanamide is sourced from PubChem (CID 18949728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).