About N-octanoyloctanamide;hydrobromide
N-octanoyloctanamide;hydrobromide (PubChem CID 175059894) has the molecular formula C16H32BrNO2
and a molecular weight of 350.34 g/mol. Its IUPAC name is N-octanoyloctanamide;hydrobromide.
Molecular Properties
| Compound Name | N-octanoyloctanamide;hydrobromide |
| PubChem CID | 175059894 |
| Molecular Formula | C16H32BrNO2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-octanoyloctanamide;hydrobromide |
| SMILES | Br.CCCCCCCC(=O)NC(=O)CCCCCCC |
| InChI | InChI=1S/C16H31NO2.BrH/c1-3-5-7-9-11-13-15(18)17-16(19)14-12-10-8-6-4-2;/h3-14H2,1-2H3,(H,17,18,19);1H |
| InChIKey | QTAAXUGPUMZEJJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-octanoyloctanamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octanoyloctanamide;hydrobromide?
The IUPAC name of N-octanoyloctanamide;hydrobromide (CID 175059894) is N-octanoyloctanamide;hydrobromide.
What is the SMILES notation for N-octanoyloctanamide;hydrobromide?
The canonical SMILES for N-octanoyloctanamide;hydrobromide is Br.CCCCCCCC(=O)NC(=O)CCCCCCC.
What is the InChIKey of N-octanoyloctanamide;hydrobromide?
The InChIKey is QTAAXUGPUMZEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2.BrH/c1-3-5-7-9-11-13-15(18)17-16(19)14-12-10-8-6-4-2;/h3-14H2,1-2H3,(H,17,18,19);1H.
What are the key properties of N-octanoyloctanamide;hydrobromide?
N-octanoyloctanamide;hydrobromide has a molecular weight of 350.34 g/mol, XLogP of 4.93, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-octanoyloctanamide;hydrobromide is sourced from PubChem (CID 175059894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).