C23H44N4O4 — CID 154340616
1-N',9-N'-di(heptanoyl)nonanedihydrazide (PubChem CID 154340616) has the molecular formula C23H44N4O4 and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-N',9-N'-di(heptanoyl)nonanedihydrazide.
| Compound Name | 1-N',9-N'-di(heptanoyl)nonanedihydrazide |
|---|---|
| PubChem CID | 154340616 |
| Molecular Formula | C23H44N4O4 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 1-N',9-N'-di(heptanoyl)nonanedihydrazide |
| SMILES | CCCCCCC(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)CCCCCC |
| InChI | InChI=1S/C23H44N4O4/c1-3-5-7-12-16-20(28)24-26-22(30)18-14-10-9-11-15-19-23(31)27-25-21(29)17-13-8-6-4-2/h3-19H2,1-2H3,(H,24,28)(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | ZVHQFRVSLFEGFT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|