About N-methylnonadecanamide
N-methylnonadecanamide (PubChem CID 2724821) has the molecular formula C20H41NO
and a molecular weight of 311.55 g/mol. Its IUPAC name is N-methylnonadecanamide.
Molecular Properties
| Compound Name | N-methylnonadecanamide |
| PubChem CID | 2724821 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | N-methylnonadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCCC(=O)NC |
| InChI | InChI=1S/C20H41NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21-2/h3-19H2,1-2H3,(H,21,22) |
| InChIKey | JJOVCQBPDCSFDT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylnonadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylnonadecanamide?
The IUPAC name of N-methylnonadecanamide (CID 2724821) is N-methylnonadecanamide.
What is the SMILES notation for N-methylnonadecanamide?
The canonical SMILES for N-methylnonadecanamide is CCCCCCCCCCCCCCCCCCC(=O)NC.
What is the InChIKey of N-methylnonadecanamide?
The InChIKey is JJOVCQBPDCSFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21-2/h3-19H2,1-2H3,(H,21,22).
What are the key properties of N-methylnonadecanamide?
N-methylnonadecanamide has a molecular weight of 311.55 g/mol, XLogP of 6.38, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylnonadecanamide is sourced from PubChem (CID 2724821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).