C9H18N2O2 — CID 15166696
N,N'-dimethylheptanediamide (PubChem CID 15166696) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N,N'-dimethylheptanediamide.
| Compound Name | N,N'-dimethylheptanediamide |
|---|---|
| PubChem CID | 15166696 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N,N'-dimethylheptanediamide |
| SMILES | CNC(=O)CCCCCC(=O)NC |
| InChI | InChI=1S/C9H18N2O2/c1-10-8(12)6-4-3-5-7-9(13)11-2/h3-7H2,1-2H3,(H,10,12)(H,11,13) |
| InChIKey | JRIRAKOCKQLZSZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|