About ethane;N-methyltetradecanamide
ethane;N-methyltetradecanamide (PubChem CID 153349961) has the molecular formula C17H37NO
and a molecular weight of 271.49 g/mol. Its IUPAC name is ethane;N-methyltetradecanamide.
Molecular Properties
| Compound Name | ethane;N-methyltetradecanamide |
| PubChem CID | 153349961 |
| Molecular Formula | C17H37NO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.29 |
| IUPAC Name | ethane;N-methyltetradecanamide |
| SMILES | CC.CCCCCCCCCCCCCC(=O)NC |
| InChI | InChI=1S/C15H31NO.C2H6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16-2;1-2/h3-14H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | YAFRNEFOXQJQMV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyltetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyltetradecanamide?
The IUPAC name of ethane;N-methyltetradecanamide (CID 153349961) is ethane;N-methyltetradecanamide.
What is the SMILES notation for ethane;N-methyltetradecanamide?
The canonical SMILES for ethane;N-methyltetradecanamide is CC.CCCCCCCCCCCCCC(=O)NC.
What is the InChIKey of ethane;N-methyltetradecanamide?
The InChIKey is YAFRNEFOXQJQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO.C2H6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16-2;1-2/h3-14H2,1-2H3,(H,16,17);1-2H3.
What are the key properties of ethane;N-methyltetradecanamide?
ethane;N-methyltetradecanamide has a molecular weight of 271.49 g/mol, XLogP of 5.46, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyltetradecanamide is sourced from PubChem (CID 153349961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).