C15H32N2O2 — CID 90794993
N,N-dimethylhexanamide;N-methylhexanamide (PubChem CID 90794993) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is N,N-dimethylhexanamide;N-methylhexanamide.
| Compound Name | N,N-dimethylhexanamide;N-methylhexanamide |
|---|---|
| PubChem CID | 90794993 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | N,N-dimethylhexanamide;N-methylhexanamide |
| SMILES | CCCCCC(=O)N(C)C.CCCCCC(=O)NC |
| InChI | InChI=1S/C8H17NO.C7H15NO/c1-4-5-6-7-8(10)9(2)3;1-3-4-5-6-7(9)8-2/h4-7H2,1-3H3;3-6H2,1-2H3,(H,8,9) |
| InChIKey | OJIIECSJKQBJRP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|