About azane;N,N-dimethyltetradecanamide;hydrochloride
azane;N,N-dimethyltetradecanamide;hydrochloride (PubChem CID 174348000) has the molecular formula C16H37ClN2O
and a molecular weight of 308.94 g/mol. Its IUPAC name is azane;N,N-dimethyltetradecanamide;hydrochloride.
Molecular Properties
| Compound Name | azane;N,N-dimethyltetradecanamide;hydrochloride |
| PubChem CID | 174348000 |
| Molecular Formula | C16H37ClN2O |
| Molecular Weight | 308.94 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | azane;N,N-dimethyltetradecanamide;hydrochloride |
| SMILES | CCCCCCCCCCCCCC(=O)N(C)C.Cl.N |
| InChI | InChI=1S/C16H33NO.ClH.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(2)3;;/h4-15H2,1-3H3;1H;1H3 |
| InChIKey | XTCWSHFMELTMOY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;N,N-dimethyltetradecanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N,N-dimethyltetradecanamide;hydrochloride?
The IUPAC name of azane;N,N-dimethyltetradecanamide;hydrochloride (CID 174348000) is azane;N,N-dimethyltetradecanamide;hydrochloride.
What is the SMILES notation for azane;N,N-dimethyltetradecanamide;hydrochloride?
The canonical SMILES for azane;N,N-dimethyltetradecanamide;hydrochloride is CCCCCCCCCCCCCC(=O)N(C)C.Cl.N.
What is the InChIKey of azane;N,N-dimethyltetradecanamide;hydrochloride?
The InChIKey is XTCWSHFMELTMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO.ClH.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(2)3;;/h4-15H2,1-3H3;1H;1H3.
What are the key properties of azane;N,N-dimethyltetradecanamide;hydrochloride?
azane;N,N-dimethyltetradecanamide;hydrochloride has a molecular weight of 308.94 g/mol, XLogP of 5.36, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N,N-dimethyltetradecanamide;hydrochloride is sourced from PubChem (CID 174348000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).