C20H42NO5P — CID 174485021
(Z)-N,N-dimethyloctadec-9-enamide;phosphoric acid (PubChem CID 174485021) has the molecular formula C20H42NO5P and a molecular weight of 407.53 g/mol. Its IUPAC name is (Z)-N,N-dimethyloctadec-9-enamide;phosphoric acid.
| Compound Name | (Z)-N,N-dimethyloctadec-9-enamide;phosphoric acid |
|---|---|
| PubChem CID | 174485021 |
| Molecular Formula | C20H42NO5P |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (Z)-N,N-dimethyloctadec-9-enamide;phosphoric acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C20H39NO.H3O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21(2)3;1-5(2,3)4/h11-12H,4-10,13-19H2,1-3H3;(H3,1,2,3,4)/b12-11-; |
| InChIKey | NZKPCXSFJWHKEN-AFEZEDKISA-N |
| XLogP | 5.18 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|