C12H23NO — CID 13308680
(E)-N,N-dimethyldec-4-enamide (PubChem CID 13308680) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (E)-N,N-dimethyldec-4-enamide.
| Compound Name | (E)-N,N-dimethyldec-4-enamide |
|---|---|
| PubChem CID | 13308680 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E)-N,N-dimethyldec-4-enamide |
| SMILES | CCCCC/C=C/CCC(=O)N(C)C |
| InChI | InChI=1S/C12H23NO/c1-4-5-6-7-8-9-10-11-12(14)13(2)3/h8-9H,4-7,10-11H2,1-3H3/b9-8+ |
| InChIKey | PYVXGZOMHHFNPM-CMDGGOBGSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|