C22H46N2O2 — CID 155099591
N,N-dimethyldecanamide;N,N-dimethyloctanamide (PubChem CID 155099591) has the molecular formula C22H46N2O2 and a molecular weight of 370.62 g/mol. Its IUPAC name is N,N-dimethyldecanamide;N,N-dimethyloctanamide.
| Compound Name | N,N-dimethyldecanamide;N,N-dimethyloctanamide |
|---|---|
| PubChem CID | 155099591 |
| Molecular Formula | C22H46N2O2 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | N,N-dimethyldecanamide;N,N-dimethyloctanamide |
| SMILES | CCCCCCCC(=O)N(C)C.CCCCCCCCCC(=O)N(C)C |
| InChI | InChI=1S/C12H25NO.C10H21NO/c1-4-5-6-7-8-9-10-11-12(14)13(2)3;1-4-5-6-7-8-9-10(12)11(2)3/h4-11H2,1-3H3;4-9H2,1-3H3 |
| InChIKey | XOIWLGLAISUFCY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|