C14H29NO2 — CID 14819908
12-hydroxy-N,N-dimethyldodecanamide (PubChem CID 14819908) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 12-hydroxy-N,N-dimethyldodecanamide.
| Compound Name | 12-hydroxy-N,N-dimethyldodecanamide |
|---|---|
| PubChem CID | 14819908 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 12-hydroxy-N,N-dimethyldodecanamide |
| SMILES | CN(C)C(=O)CCCCCCCCCCCO |
| InChI | InChI=1S/C14H29NO2/c1-15(2)14(17)12-10-8-6-4-3-5-7-9-11-13-16/h16H,3-13H2,1-2H3 |
| InChIKey | IBUBVPXLBPCCAY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|