C21H45N3OS — CID 174811693
N,N-dimethyloctadecanamide;thiourea (PubChem CID 174811693) has the molecular formula C21H45N3OS and a molecular weight of 387.68 g/mol. Its IUPAC name is N,N-dimethyloctadecanamide;thiourea.
| Compound Name | N,N-dimethyloctadecanamide;thiourea |
|---|---|
| PubChem CID | 174811693 |
| Molecular Formula | C21H45N3OS |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 387.33 |
| IUPAC Name | N,N-dimethyloctadecanamide;thiourea |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)N(C)C.NC(N)=S |
| InChI | InChI=1S/C20H41NO.CH4N2S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21(2)3;2-1(3)4/h4-19H2,1-3H3;(H4,2,3,4) |
| InChIKey | YBXXQJWTJIELRC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|