C14H30ClNO — CID 173149987
N,N-dimethyldodecanamide;hydrochloride (PubChem CID 173149987) has the molecular formula C14H30ClNO and a molecular weight of 263.85 g/mol. Its IUPAC name is N,N-dimethyldodecanamide;hydrochloride.
| Compound Name | N,N-dimethyldodecanamide;hydrochloride |
|---|---|
| PubChem CID | 173149987 |
| Molecular Formula | C14H30ClNO |
| Molecular Weight | 263.85 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N,N-dimethyldodecanamide;hydrochloride |
| SMILES | CCCCCCCCCCCC(=O)N(C)C.Cl |
| InChI | InChI=1S/C14H29NO.ClH/c1-4-5-6-7-8-9-10-11-12-13-14(16)15(2)3;/h4-13H2,1-3H3;1H |
| InChIKey | JEKMTECVJDTNBV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|