C6H14ClNO — CID 87498306
N,N-dimethylbutanamide;hydrochloride (PubChem CID 87498306) has the molecular formula C6H14ClNO and a molecular weight of 151.64 g/mol. Its IUPAC name is N,N-dimethylbutanamide;hydrochloride.
| Compound Name | N,N-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 87498306 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | N,N-dimethylbutanamide;hydrochloride |
| SMILES | CCCC(=O)N(C)C.Cl |
| InChI | InChI=1S/C6H13NO.ClH/c1-4-5-6(8)7(2)3;/h4-5H2,1-3H3;1H |
| InChIKey | WXWGZPFEYIVCMV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |