C10H19NO — CID 13308679
(E)-N,N-dimethyloct-4-enamide (PubChem CID 13308679) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (E)-N,N-dimethyloct-4-enamide.
| Compound Name | (E)-N,N-dimethyloct-4-enamide |
|---|---|
| PubChem CID | 13308679 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (E)-N,N-dimethyloct-4-enamide |
| SMILES | CCC/C=C/CCC(=O)N(C)C |
| InChI | InChI=1S/C10H19NO/c1-4-5-6-7-8-9-10(12)11(2)3/h6-7H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | SZEWRHCACNLLMJ-VOTSOKGWSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|