C7H13NO — CID 13308678
N,N-dimethylpent-4-enamide (PubChem CID 13308678) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is N,N-dimethylpent-4-enamide.
| Compound Name | N,N-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 13308678 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N,N-dimethylpent-4-enamide |
| SMILES | C=CCCC(=O)N(C)C |
| InChI | InChI=1S/C7H13NO/c1-4-5-6-7(9)8(2)3/h4H,1,5-6H2,2-3H3 |
| InChIKey | VBIUZQGXHXBXHR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|