C8H14N2O2 — CID 19971020
N,N-dimethyl-3-(prop-2-enoylamino)propanamide (PubChem CID 19971020) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is N,N-dimethyl-3-(prop-2-enoylamino)propanamide.
| Compound Name | N,N-dimethyl-3-(prop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 19971020 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N,N-dimethyl-3-(prop-2-enoylamino)propanamide |
| SMILES | C=CC(=O)NCCC(=O)N(C)C |
| InChI | InChI=1S/C8H14N2O2/c1-4-7(11)9-6-5-8(12)10(2)3/h4H,1,5-6H2,2-3H3,(H,9,11) |
| InChIKey | UAQQYZSMBDCZLL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|