C18H32N4O3 — CID 144591761
N-[2-[bis[2-(prop-2-enoylamino)ethyl]amino]ethyl]prop-2-enamide;propane (PubChem CID 144591761) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-[bis[2-(prop-2-enoylamino)ethyl]amino]ethyl]prop-2-enamide;propane.
| Compound Name | N-[2-[bis[2-(prop-2-enoylamino)ethyl]amino]ethyl]prop-2-enamide;propane |
|---|---|
| PubChem CID | 144591761 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N-[2-[bis[2-(prop-2-enoylamino)ethyl]amino]ethyl]prop-2-enamide;propane |
| SMILES | C=CC(=O)NCCN(CCNC(=O)C=C)CCNC(=O)C=C.CCC |
| InChI | InChI=1S/C15H24N4O3.C3H8/c1-4-13(20)16-7-10-19(11-8-17-14(21)5-2)12-9-18-15(22)6-3;1-3-2/h4-6H,1-3,7-12H2,(H,16,20)(H,17,21)(H,18,22);3H2,1-2H3 |
| InChIKey | VLFNSTCVBYKUNM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|