C9H21ClN2O — CID 173003472
N,N-dimethylmethanamine;N-propylprop-2-enamide;hydrochloride (PubChem CID 173003472) has the molecular formula C9H21ClN2O and a molecular weight of 208.73 g/mol. Its IUPAC name is N,N-dimethylmethanamine;N-propylprop-2-enamide;hydrochloride.
| Compound Name | N,N-dimethylmethanamine;N-propylprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 173003472 |
| Molecular Formula | C9H21ClN2O |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N,N-dimethylmethanamine;N-propylprop-2-enamide;hydrochloride |
| SMILES | C=CC(=O)NCCC.CN(C)C.Cl |
| InChI | InChI=1S/C6H11NO.C3H9N.ClH/c1-3-5-7-6(8)4-2;1-4(2)3;/h4H,2-3,5H2,1H3,(H,7,8);1-3H3;1H |
| InChIKey | CLQAIPMPVHYANA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|