C7H16N2O — CID 176682975
N-[2-(dimethylamino)ethyl]prop-2-enamide;molecular hydrogen (PubChem CID 176682975) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]prop-2-enamide;molecular hydrogen.
| Compound Name | N-[2-(dimethylamino)ethyl]prop-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 176682975 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]prop-2-enamide;molecular hydrogen |
| SMILES | C=CC(=O)NCCN(C)C.[H][H] |
| InChI | InChI=1S/C7H14N2O.H2/c1-4-7(10)8-5-6-9(2)3;/h4H,1,5-6H2,2-3H3,(H,8,10);1H |
| InChIKey | GBUNFCOPZOVXDD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|