C21H43N3O — CID 118567429
N-[3-[12-(dimethylamino)dodecyl-methylamino]propyl]prop-2-enamide (PubChem CID 118567429) has the molecular formula C21H43N3O and a molecular weight of 353.60 g/mol. Its IUPAC name is N-[3-[12-(dimethylamino)dodecyl-methylamino]propyl]prop-2-enamide.
| Compound Name | N-[3-[12-(dimethylamino)dodecyl-methylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 118567429 |
| Molecular Formula | C21H43N3O |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 353.34 |
| IUPAC Name | N-[3-[12-(dimethylamino)dodecyl-methylamino]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCN(C)CCCCCCCCCCCCN(C)C |
| InChI | InChI=1S/C21H43N3O/c1-5-21(25)22-17-16-20-24(4)19-15-13-11-9-7-6-8-10-12-14-18-23(2)3/h5H,1,6-20H2,2-4H3,(H,22,25) |
| InChIKey | CVGKKPDONMAWJP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|