C8H16N2O2 — CID 144591746
N-[2-[2-hydroxyethyl(methyl)amino]ethyl]prop-2-enamide (PubChem CID 144591746) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N-[2-[2-hydroxyethyl(methyl)amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[2-hydroxyethyl(methyl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 144591746 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N-[2-[2-hydroxyethyl(methyl)amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCN(C)CCO |
| InChI | InChI=1S/C8H16N2O2/c1-3-8(12)9-4-5-10(2)6-7-11/h3,11H,1,4-7H2,2H3,(H,9,12) |
| InChIKey | IRLMMWOVBVAEFE-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|