C11H26Cl2N4O2 — CID 163331599
(2E)-N-[3-[3-(dimethylamino)propyl-methylamino]propyl]-2-hydroxyiminoacetamide;dihydrochloride (PubChem CID 163331599) has the molecular formula C11H26Cl2N4O2 and a molecular weight of 317.26 g/mol. Its IUPAC name is (2E)-N-[3-[3-(dimethylamino)propyl-methylamino]propyl]-2-hydroxyiminoacetamide;dihydrochloride.
| Compound Name | (2E)-N-[3-[3-(dimethylamino)propyl-methylamino]propyl]-2-hydroxyiminoacetamide;dihydrochloride |
|---|---|
| PubChem CID | 163331599 |
| Molecular Formula | C11H26Cl2N4O2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2E)-N-[3-[3-(dimethylamino)propyl-methylamino]propyl]-2-hydroxyiminoacetamide;dihydrochloride |
| SMILES | CN(C)CCCN(C)CCCNC(=O)/C=N/O.Cl.Cl |
| InChI | InChI=1S/C11H24N4O2.2ClH/c1-14(2)7-5-9-15(3)8-4-6-12-11(16)10-13-17;;/h10,17H,4-9H2,1-3H3,(H,12,16);2*1H/b13-10+;; |
| InChIKey | MXDICCKRGROUDJ-JFXLULTRSA-N |
| XLogP | 0.68 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|