C11H22N6O4 — CID 73254220
(2E)-2-hydroxyimino-N-[2-[3-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethylamino]propylamino]ethyl]acetamide (PubChem CID 73254220) has the molecular formula C11H22N6O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[2-[3-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethylamino]propylamino]ethyl]acetamide.
| Compound Name | (2E)-2-hydroxyimino-N-[2-[3-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethylamino]propylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 73254220 |
| Molecular Formula | C11H22N6O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[2-[3-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethylamino]propylamino]ethyl]acetamide |
| SMILES | O=C(/C=N/O)NCCNCCCNCCNC(=O)/C=N/O |
| InChI | InChI=1S/C11H22N6O4/c18-10(8-16-20)14-6-4-12-2-1-3-13-5-7-15-11(19)9-17-21/h8-9,12-13,20-21H,1-7H2,(H,14,18)(H,15,19)/b16-8+,17-9+ |
| InChIKey | JYNMSPLTJVXXPQ-GONBZBRSSA-N |
| XLogP | -2.29 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|