C10H22N3O2+ — CID 6408182
6-[[(2Z)-2-hydroxyiminoacetyl]amino]hexyl-dimethylazanium (PubChem CID 6408182) has the molecular formula C10H22N3O2+ and a molecular weight of 216.30 g/mol. Its IUPAC name is 6-[[(2Z)-2-hydroxyiminoacetyl]amino]hexyl-dimethylazanium.
| Compound Name | 6-[[(2Z)-2-hydroxyiminoacetyl]amino]hexyl-dimethylazanium |
|---|---|
| PubChem CID | 6408182 |
| Molecular Formula | C10H22N3O2+ |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 6-[[(2Z)-2-hydroxyiminoacetyl]amino]hexyl-dimethylazanium |
| SMILES | C[NH+](C)CCCCCCNC(=O)/C=N\O |
| InChI | InChI=1S/C10H21N3O2/c1-13(2)8-6-4-3-5-7-11-10(14)9-12-15/h9,15H,3-8H2,1-2H3,(H,11,14)/p+1/b12-9- |
| InChIKey | ZGQDIUFPYYFSGU-XFXZXTDPSA-O |
| XLogP | -0.73 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|