C9H21ClN4O2 — CID 11958871
N-[2-[3-(dimethylamino)propylamino]ethyl]-2-hydroxyiminoacetamide;hydrochloride (PubChem CID 11958871) has the molecular formula C9H21ClN4O2 and a molecular weight of 252.75 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propylamino]ethyl]-2-hydroxyiminoacetamide;hydrochloride.
| Compound Name | N-[2-[3-(dimethylamino)propylamino]ethyl]-2-hydroxyiminoacetamide;hydrochloride |
|---|---|
| PubChem CID | 11958871 |
| Molecular Formula | C9H21ClN4O2 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-[2-[3-(dimethylamino)propylamino]ethyl]-2-hydroxyiminoacetamide;hydrochloride |
| SMILES | CN(C)CCCNCCNC(=O)C=NO.Cl |
| InChI | InChI=1S/C9H20N4O2.ClH/c1-13(2)7-3-4-10-5-6-11-9(14)8-12-15;/h8,10,15H,3-7H2,1-2H3,(H,11,14);1H |
| InChIKey | NMGCDGVVCSCJOC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|