C13H29N5O2 — CID 171151800
N-[3-[3-[3-(dimethylamino)propylamino]propylamino]propyl]-2-hydroxyiminoacetamide (PubChem CID 171151800) has the molecular formula C13H29N5O2 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[3-[3-[3-(dimethylamino)propylamino]propylamino]propyl]-2-hydroxyiminoacetamide.
| Compound Name | N-[3-[3-[3-(dimethylamino)propylamino]propylamino]propyl]-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 171151800 |
| Molecular Formula | C13H29N5O2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | N-[3-[3-[3-(dimethylamino)propylamino]propylamino]propyl]-2-hydroxyiminoacetamide |
| SMILES | CN(C)CCCNCCCNCCCNC(=O)C=NO |
| InChI | InChI=1S/C13H29N5O2/c1-18(2)11-5-9-15-7-3-6-14-8-4-10-16-13(19)12-17-20/h12,14-15,20H,3-11H2,1-2H3,(H,16,19) |
| InChIKey | QHQKUPYSIJPWQD-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|